C14H25N3O2 — CID 82952880
3-(aminomethyl)-N,N-bis(2-ethoxyethyl)pyridin-4-amine (PubChem CID 82952880) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-(aminomethyl)-N,N-bis(2-ethoxyethyl)pyridin-4-amine.
| Compound Name | 3-(aminomethyl)-N,N-bis(2-ethoxyethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 82952880 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 3-(aminomethyl)-N,N-bis(2-ethoxyethyl)pyridin-4-amine |
| SMILES | CCOCCN(CCOCC)c1ccncc1CN |
| InChI | InChI=1S/C14H25N3O2/c1-3-18-9-7-17(8-10-19-4-2)14-5-6-16-12-13(14)11-15/h5-6,12H,3-4,7-11,15H2,1-2H3 |
| InChIKey | QVKWOEBRQCPNJI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|