C12H19N3 — CID 81247312
3-(aminomethyl)-N-(cyclopropylmethyl)-N-ethylpyridin-4-amine (PubChem CID 81247312) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(cyclopropylmethyl)-N-ethylpyridin-4-amine.
| Compound Name | 3-(aminomethyl)-N-(cyclopropylmethyl)-N-ethylpyridin-4-amine |
|---|---|
| PubChem CID | 81247312 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3-(aminomethyl)-N-(cyclopropylmethyl)-N-ethylpyridin-4-amine |
| SMILES | CCN(CC1CC1)c1ccncc1CN |
| InChI | InChI=1S/C12H19N3/c1-2-15(9-10-3-4-10)12-5-6-14-8-11(12)7-13/h5-6,8,10H,2-4,7,9,13H2,1H3 |
| InChIKey | CXPIOMYWOBMJAP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |