C11H14N2O3S — CID 79325861
ethyl 3-amino-2-(oxetan-3-ylsulfanyl)pyridine-4-carboxylate (PubChem CID 79325861) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is ethyl 3-amino-2-(oxetan-3-ylsulfanyl)pyridine-4-carboxylate.
| Compound Name | ethyl 3-amino-2-(oxetan-3-ylsulfanyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 79325861 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | ethyl 3-amino-2-(oxetan-3-ylsulfanyl)pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(SC2COC2)c1N |
| InChI | InChI=1S/C11H14N2O3S/c1-2-16-11(14)8-3-4-13-10(9(8)12)17-7-5-15-6-7/h3-4,7H,2,5-6,12H2,1H3 |
| InChIKey | PSZAOBXOIBBUGO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |