C11H12F3NO3 — CID 103996530
ethyl 2-amino-3-(2,2-difluoroethoxy)-5-fluorobenzoate (PubChem CID 103996530) has the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. Its IUPAC name is ethyl 2-amino-3-(2,2-difluoroethoxy)-5-fluorobenzoate.
| Compound Name | ethyl 2-amino-3-(2,2-difluoroethoxy)-5-fluorobenzoate |
|---|---|
| PubChem CID | 103996530 |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | ethyl 2-amino-3-(2,2-difluoroethoxy)-5-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(F)cc(OCC(F)F)c1N |
| InChI | InChI=1S/C11H12F3NO3/c1-2-17-11(16)7-3-6(12)4-8(10(7)15)18-5-9(13)14/h3-4,9H,2,5,15H2,1H3 |
| InChIKey | LXVCZDLQJUUHGH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|