About ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate
ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate (PubChem CID 87426994) has the molecular formula C11H13F2NO3
and a molecular weight of 245.22 g/mol. Its IUPAC name is ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate.
Analyze ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate?
The IUPAC name of ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate (CID 87426994) is ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate.
What is the SMILES notation for ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate?
The canonical SMILES for ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate is CCOC(=O)c1ccc(OCC(F)F)nc1C.
What is the InChIKey of ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate?
The InChIKey is QDNKOBOUGUASLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO3/c1-3-16-11(15)8-4-5-10(14-7(8)2)17-6-9(12)13/h4-5,9H,3,6H2,1-2H3.
What are the key properties of ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate?
ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate has a molecular weight of 245.22 g/mol, XLogP of 2.21, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-(2,2-difluoroethoxy)-2-methylpyridine-3-carboxylate is sourced from PubChem (CID 87426994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).