C9H8BrCl2NO2 — CID 46899908
ethyl 3-(bromomethyl)-2,6-dichloropyridine-4-carboxylate (PubChem CID 46899908) has the molecular formula C9H8BrCl2NO2 and a molecular weight of 312.98 g/mol. Its IUPAC name is ethyl 3-(bromomethyl)-2,6-dichloropyridine-4-carboxylate.
| Compound Name | ethyl 3-(bromomethyl)-2,6-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 46899908 |
| Molecular Formula | C9H8BrCl2NO2 |
| Molecular Weight | 312.98 g/mol |
| Exact Mass | 310.91 |
| IUPAC Name | ethyl 3-(bromomethyl)-2,6-dichloropyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(Cl)nc(Cl)c1CBr |
| InChI | InChI=1S/C9H8BrCl2NO2/c1-2-15-9(14)5-3-7(11)13-8(12)6(5)4-10/h3H,2,4H2,1H3 |
| InChIKey | BDUOJIQTMXHTOI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.98 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|