C12H9F3N2O2 — CID 2782648
ethyl 2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylate (PubChem CID 2782648) has the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. Its IUPAC name is ethyl 2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 2782648 |
| Molecular Formula | C12H9F3N2O2 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | ethyl 2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc2cccnc2nc1C(F)(F)F |
| InChI | InChI=1S/C12H9F3N2O2/c1-2-19-11(18)8-6-7-4-3-5-16-10(7)17-9(8)12(13,14)15/h3-6H,2H2,1H3 |
| InChIKey | XKMRJSFJQOOMKF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |