C14H11F3N2O2 — CID 3522145
ethyl 2-phenyl-4-(trifluoromethyl)pyrimidine-5-carboxylate (PubChem CID 3522145) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is ethyl 2-phenyl-4-(trifluoromethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-phenyl-4-(trifluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3522145 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | ethyl 2-phenyl-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ccccc2)nc1C(F)(F)F |
| InChI | InChI=1S/C14H11F3N2O2/c1-2-21-13(20)10-8-18-12(9-6-4-3-5-7-9)19-11(10)14(15,16)17/h3-8H,2H2,1H3 |
| InChIKey | OCELIATZYRALPP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |