C13H11F3N2O2S — CID 102972564
ethyl 2-(thiophen-2-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxylate (PubChem CID 102972564) has the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. Its IUPAC name is ethyl 2-(thiophen-2-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(thiophen-2-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 102972564 |
| Molecular Formula | C13H11F3N2O2S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | ethyl 2-(thiophen-2-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cc2cccs2)nc1C(F)(F)F |
| InChI | InChI=1S/C13H11F3N2O2S/c1-2-20-12(19)9-7-17-10(6-8-4-3-5-21-8)18-11(9)13(14,15)16/h3-5,7H,2,6H2,1H3 |
| InChIKey | ZDRQYEUJMCQIAU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |