C16H12F6N4O3 — CID 2808669
ethyl 2-[[amino-[4-(trifluoromethyl)phenyl]methylidene]amino]oxy-4-(trifluoromethyl)pyrimidine-5-carboxylate (PubChem CID 2808669) has the molecular formula C16H12F6N4O3 and a molecular weight of 422.29 g/mol. Its IUPAC name is ethyl 2-[[amino-[4-(trifluoromethyl)phenyl]methylidene]amino]oxy-4-(trifluoromethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[[amino-[4-(trifluoromethyl)phenyl]methylidene]amino]oxy-4-(trifluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2808669 |
| Molecular Formula | C16H12F6N4O3 |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | ethyl 2-[[amino-[4-(trifluoromethyl)phenyl]methylidene]amino]oxy-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(ON=C(N)c2ccc(C(F)(F)F)cc2)nc1C(F)(F)F |
| InChI | InChI=1S/C16H12F6N4O3/c1-2-28-13(27)10-7-24-14(25-11(10)16(20,21)22)29-26-12(23)8-3-5-9(6-4-8)15(17,18)19/h3-7H,2H2,1H3,(H2,23,26) |
| InChIKey | VDESHZYKDFZXES-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|