C11H6F10N2O2 — CID 58542568
ethyl 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)pyrimidine-5-carboxylate (PubChem CID 58542568) has the molecular formula C11H6F10N2O2 and a molecular weight of 388.16 g/mol. Its IUPAC name is ethyl 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 58542568 |
| Molecular Formula | C11H6F10N2O2 |
| Molecular Weight | 388.16 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | ethyl 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C(F)(F)C(F)(F)C(F)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C11H6F10N2O2/c1-2-25-6(24)4-3-22-7(23-5(4)9(14,15)16)8(12,13)10(17,18)11(19,20)21/h3H,2H2,1H3 |
| InChIKey | PEXHGZUEDALTIJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.16 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|