C9H2F10N2O2 — CID 58542523
2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)pyrimidine-5-carboxylic acid (PubChem CID 58542523) has the molecular formula C9H2F10N2O2 and a molecular weight of 360.11 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 58542523 |
| Molecular Formula | C9H2F10N2O2 |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(C(F)(F)C(F)(F)C(F)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C9H2F10N2O2/c10-6(11,8(15,16)9(17,18)19)5-20-1-2(4(22)23)3(21-5)7(12,13)14/h1H,(H,22,23) |
| InChIKey | RJRFOJNPNOXGEL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|