C9H9F5N4O2 — CID 21220651
ethyl 2-hydrazinyl-4-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carboxylate (PubChem CID 21220651) has the molecular formula C9H9F5N4O2 and a molecular weight of 300.19 g/mol. Its IUPAC name is ethyl 2-hydrazinyl-4-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-hydrazinyl-4-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 21220651 |
| Molecular Formula | C9H9F5N4O2 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | ethyl 2-hydrazinyl-4-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NN)nc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F5N4O2/c1-2-20-6(19)4-3-16-7(18-15)17-5(4)8(10,11)9(12,13)14/h3H,2,15H2,1H3,(H,16,17,18) |
| InChIKey | ZZCKBUPYMPIQJO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|