C11H11ClN4O2S — CID 131850390
ethyl 4-(5-chlorothiophen-2-yl)-2-hydrazinylpyrimidine-5-carboxylate (PubChem CID 131850390) has the molecular formula C11H11ClN4O2S and a molecular weight of 298.76 g/mol. Its IUPAC name is ethyl 4-(5-chlorothiophen-2-yl)-2-hydrazinylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(5-chlorothiophen-2-yl)-2-hydrazinylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 131850390 |
| Molecular Formula | C11H11ClN4O2S |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | ethyl 4-(5-chlorothiophen-2-yl)-2-hydrazinylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NN)nc1-c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H11ClN4O2S/c1-2-18-10(17)6-5-14-11(16-13)15-9(6)7-3-4-8(12)19-7/h3-5H,2,13H2,1H3,(H,14,15,16) |
| InChIKey | RRIBRBNPLAXBFN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|