C9H12ClN3O2 — CID 102973317
ethyl 4-(chloromethyl)-2-(methylamino)pyrimidine-5-carboxylate (PubChem CID 102973317) has the molecular formula C9H12ClN3O2 and a molecular weight of 229.67 g/mol. Its IUPAC name is ethyl 4-(chloromethyl)-2-(methylamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(chloromethyl)-2-(methylamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 102973317 |
| Molecular Formula | C9H12ClN3O2 |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | ethyl 4-(chloromethyl)-2-(methylamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC)nc1CCl |
| InChI | InChI=1S/C9H12ClN3O2/c1-3-15-8(14)6-5-12-9(11-2)13-7(6)4-10/h5H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | AKKDCWIHPJDCEZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|