C10H10ClF3N2O2 — CID 102973367
ethyl 4-(chloromethyl)-2-(2,2,2-trifluoroethyl)pyrimidine-5-carboxylate (PubChem CID 102973367) has the molecular formula C10H10ClF3N2O2 and a molecular weight of 282.65 g/mol. Its IUPAC name is ethyl 4-(chloromethyl)-2-(2,2,2-trifluoroethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(chloromethyl)-2-(2,2,2-trifluoroethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 102973367 |
| Molecular Formula | C10H10ClF3N2O2 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | ethyl 4-(chloromethyl)-2-(2,2,2-trifluoroethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CC(F)(F)F)nc1CCl |
| InChI | InChI=1S/C10H10ClF3N2O2/c1-2-18-9(17)6-5-15-8(3-10(12,13)14)16-7(6)4-11/h5H,2-4H2,1H3 |
| InChIKey | ULQIIKWLLHXEOA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|