ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate

C12H15F3N2O2 — CID 102972902

IUPACethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate
SMILESCCOC(=O)c1cnc(CCC(F)(F)F)nc1CC
InChIInChI=1S/C12H15F3N2O2/c1-3-9-8(11(18)19-4-2)7-16-10(17-9)5-6-12(13,14)15/h7H,3-6H2,1-2H3
InChIKeyOOMXNDFRIORWID-UHFFFAOYSA-N
MW276.26 g/mol
LogP2.71
Rot. Bonds5

About ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate

ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate (PubChem CID 102972902) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate.

Molecular Properties

Compound Nameethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate
PubChem CID102972902
Molecular FormulaC12H15F3N2O2
Molecular Weight276.26 g/mol
Exact Mass276.11
IUPAC Nameethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate
SMILESCCOC(=O)c1cnc(CCC(F)(F)F)nc1CC
InChIInChI=1S/C12H15F3N2O2/c1-3-9-8(11(18)19-4-2)7-16-10(17-9)5-6-12(13,14)15/h7H,3-6H2,1-2H3
InChIKeyOOMXNDFRIORWID-UHFFFAOYSA-N
XLogP2.71
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.26
LogP ≤ 52.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate?
The IUPAC name of ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate (CID 102972902) is ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate is CCOC(=O)c1cnc(CCC(F)(F)F)nc1CC.
What is the InChIKey of ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate?
The InChIKey is OOMXNDFRIORWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O2/c1-3-9-8(11(18)19-4-2)7-16-10(17-9)5-6-12(13,14)15/h7H,3-6H2,1-2H3.
What are the key properties of ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate?
ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate has a molecular weight of 276.26 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-ethyl-2-(3,3,3-trifluoropropyl)pyrimidine-5-carboxylate is sourced from PubChem (CID 102972902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).