C8H12N4O2 — CID 116646909
ethyl 4-amino-2-(methylamino)pyrimidine-5-carboxylate (PubChem CID 116646909) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is ethyl 4-amino-2-(methylamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(methylamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 116646909 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | ethyl 4-amino-2-(methylamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC)nc1N |
| InChI | InChI=1S/C8H12N4O2/c1-3-14-7(13)5-4-11-8(10-2)12-6(5)9/h4H,3H2,1-2H3,(H3,9,10,11,12) |
| InChIKey | ROQRPXKATQJFTD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |