C10H15N3O3 — CID 116646813
ethyl 4-amino-2-(ethoxymethyl)pyrimidine-5-carboxylate (PubChem CID 116646813) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is ethyl 4-amino-2-(ethoxymethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(ethoxymethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 116646813 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | ethyl 4-amino-2-(ethoxymethyl)pyrimidine-5-carboxylate |
| SMILES | CCOCc1ncc(C(=O)OCC)c(N)n1 |
| InChI | InChI=1S/C10H15N3O3/c1-3-15-6-8-12-5-7(9(11)13-8)10(14)16-4-2/h5H,3-4,6H2,1-2H3,(H2,11,12,13) |
| InChIKey | ZPLIBQGAZPIBMP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |