C9H14N4O2 — CID 71220661
ethyl 4-amino-2-(dimethylamino)pyrimidine-5-carboxylate (PubChem CID 71220661) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is ethyl 4-amino-2-(dimethylamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(dimethylamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 71220661 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | ethyl 4-amino-2-(dimethylamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(N(C)C)nc1N |
| InChI | InChI=1S/C9H14N4O2/c1-4-15-8(14)6-5-11-9(13(2)3)12-7(6)10/h5H,4H2,1-3H3,(H2,10,11,12) |
| InChIKey | DETJDBAZIFHJAT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |