C11H13F4N3O3 — CID 103477235
ethyl 4-amino-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine-5-carboxylate (PubChem CID 103477235) has the molecular formula C11H13F4N3O3 and a molecular weight of 311.24 g/mol. Its IUPAC name is ethyl 4-amino-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 103477235 |
| Molecular Formula | C11H13F4N3O3 |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | ethyl 4-amino-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(COCC(F)(F)C(F)F)nc1N |
| InChI | InChI=1S/C11H13F4N3O3/c1-2-21-9(19)6-3-17-7(18-8(6)16)4-20-5-11(14,15)10(12)13/h3,10H,2,4-5H2,1H3,(H2,16,17,18) |
| InChIKey | ITSZMSVQBNJNDX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|