C10H11F4NO3S — CID 103473342
ethyl 2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole-4-carboxylate (PubChem CID 103473342) has the molecular formula C10H11F4NO3S and a molecular weight of 301.26 g/mol. Its IUPAC name is ethyl 2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 103473342 |
| Molecular Formula | C10H11F4NO3S |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | ethyl 2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C10H11F4NO3S/c1-2-18-8(16)6-4-19-7(15-6)3-17-5-10(13,14)9(11)12/h4,9H,2-3,5H2,1H3 |
| InChIKey | QHGJLRMMWWVRHX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|