C7H8F4N2OS — CID 103477015
2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-amine (PubChem CID 103477015) has the molecular formula C7H8F4N2OS and a molecular weight of 244.21 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-amine.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 103477015 |
| Molecular Formula | C7H8F4N2OS |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-amine |
| SMILES | Nc1csc(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C7H8F4N2OS/c8-6(9)7(10,11)3-14-1-5-13-4(12)2-15-5/h2,6H,1,3,12H2 |
| InChIKey | KBCIMCYSMJPKBS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|