C8H10F4N2OS — CID 103476022
[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]methanamine (PubChem CID 103476022) has the molecular formula C8H10F4N2OS and a molecular weight of 258.24 g/mol. Its IUPAC name is [2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 103476022 |
| Molecular Formula | C8H10F4N2OS |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | [2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]methanamine |
| SMILES | NCc1cnc(COCC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C8H10F4N2OS/c9-7(10)8(11,12)4-15-3-6-14-2-5(1-13)16-6/h2,7H,1,3-4,13H2 |
| InChIKey | DGDWAUUEMHLPLX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|