C9H9F4NO3S — CID 103473361
2-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 103473361) has the molecular formula C9H9F4NO3S and a molecular weight of 287.23 g/mol. Its IUPAC name is 2-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 103473361 |
| Molecular Formula | C9H9F4NO3S |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C9H9F4NO3S/c10-8(11)9(12,13)4-17-2-6-14-5(3-18-6)1-7(15)16/h3,8H,1-2,4H2,(H,15,16) |
| InChIKey | BLFMQIABYVYGGC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|