C12H16F4N2OS — CID 103477119
4-piperidin-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole (PubChem CID 103477119) has the molecular formula C12H16F4N2OS and a molecular weight of 312.33 g/mol. Its IUPAC name is 4-piperidin-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole.
| Compound Name | 4-piperidin-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 103477119 |
| Molecular Formula | C12H16F4N2OS |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 4-piperidin-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole |
| SMILES | FC(F)C(F)(F)COCc1nc(C2CCCCN2)cs1 |
| InChI | InChI=1S/C12H16F4N2OS/c13-11(14)12(15,16)7-19-5-10-18-9(6-20-10)8-3-1-2-4-17-8/h6,8,11,17H,1-5,7H2 |
| InChIKey | WSJKUVIVXBGYCO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|