C8H12N2OS — CID 104853412
[4-[(2R)-pyrrolidin-2-yl]-1,3-thiazol-2-yl]methanol (PubChem CID 104853412) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is [4-[(2R)-pyrrolidin-2-yl]-1,3-thiazol-2-yl]methanol.
| Compound Name | [4-[(2R)-pyrrolidin-2-yl]-1,3-thiazol-2-yl]methanol |
|---|---|
| PubChem CID | 104853412 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | [4-[(2R)-pyrrolidin-2-yl]-1,3-thiazol-2-yl]methanol |
| SMILES | OCc1nc([C@H]2CCCN2)cs1 |
| InChI | InChI=1S/C8H12N2OS/c11-4-8-10-7(5-12-8)6-2-1-3-9-6/h5-6,9,11H,1-4H2/t6-/m1/s1 |
| InChIKey | YMQXZLGZAFZTJU-ZCFIWIBFSA-N |
| XLogP | 1.06 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |