C9H14N2OS — CID 95430246
2-(methoxymethyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazole (PubChem CID 95430246) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-(methoxymethyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazole.
| Compound Name | 2-(methoxymethyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 95430246 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-(methoxymethyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazole |
| SMILES | COCc1nc([C@@H]2CCCN2)cs1 |
| InChI | InChI=1S/C9H14N2OS/c1-12-5-9-11-8(6-13-9)7-3-2-4-10-7/h6-7,10H,2-5H2,1H3/t7-/m0/s1 |
| InChIKey | DIOKXRTVHAMHFH-ZETCQYMHSA-N |
| XLogP | 1.71 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |