C13H15N3S — CID 114456781
2-(pyridin-4-ylmethyl)-4-pyrrolidin-2-yl-1,3-thiazole (PubChem CID 114456781) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is 2-(pyridin-4-ylmethyl)-4-pyrrolidin-2-yl-1,3-thiazole.
| Compound Name | 2-(pyridin-4-ylmethyl)-4-pyrrolidin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 114456781 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-(pyridin-4-ylmethyl)-4-pyrrolidin-2-yl-1,3-thiazole |
| SMILES | c1cc(Cc2nc(C3CCCN3)cs2)ccn1 |
| InChI | InChI=1S/C13H15N3S/c1-2-11(15-5-1)12-9-17-13(16-12)8-10-3-6-14-7-4-10/h3-4,6-7,9,11,15H,1-2,5,8H2 |
| InChIKey | WEQPJJICGUKGLJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |