C14H15FN2S — CID 104928674
2-[(3-fluorophenyl)methyl]-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazole (PubChem CID 104928674) has the molecular formula C14H15FN2S and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazole.
| Compound Name | 2-[(3-fluorophenyl)methyl]-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 104928674 |
| Molecular Formula | C14H15FN2S |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazole |
| SMILES | Fc1cccc(Cc2nc([C@@H]3CCCN3)cs2)c1 |
| InChI | InChI=1S/C14H15FN2S/c15-11-4-1-3-10(7-11)8-14-17-13(9-18-14)12-5-2-6-16-12/h1,3-4,7,9,12,16H,2,5-6,8H2/t12-/m0/s1 |
| InChIKey | FVYVYLCTWXIYCI-LBPRGKRZSA-N |
| XLogP | 3.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |