C12H14N2S2 — CID 104928655
4-[(2S)-pyrrolidin-2-yl]-2-(thiophen-2-ylmethyl)-1,3-thiazole (PubChem CID 104928655) has the molecular formula C12H14N2S2 and a molecular weight of 250.39 g/mol. Its IUPAC name is 4-[(2S)-pyrrolidin-2-yl]-2-(thiophen-2-ylmethyl)-1,3-thiazole.
| Compound Name | 4-[(2S)-pyrrolidin-2-yl]-2-(thiophen-2-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 104928655 |
| Molecular Formula | C12H14N2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-[(2S)-pyrrolidin-2-yl]-2-(thiophen-2-ylmethyl)-1,3-thiazole |
| SMILES | c1csc(Cc2nc([C@@H]3CCCN3)cs2)c1 |
| InChI | InChI=1S/C12H14N2S2/c1-4-10(13-5-1)11-8-16-12(14-11)7-9-3-2-6-15-9/h2-3,6,8,10,13H,1,4-5,7H2/t10-/m0/s1 |
| InChIKey | OTRFGNZRTNZKFW-JTQLQIEISA-N |
| XLogP | 3.22 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |