C10H13F3N2S — CID 114456941
4-pyrrolidin-2-yl-2-(3,3,3-trifluoropropyl)-1,3-thiazole (PubChem CID 114456941) has the molecular formula C10H13F3N2S and a molecular weight of 250.29 g/mol. Its IUPAC name is 4-pyrrolidin-2-yl-2-(3,3,3-trifluoropropyl)-1,3-thiazole.
| Compound Name | 4-pyrrolidin-2-yl-2-(3,3,3-trifluoropropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 114456941 |
| Molecular Formula | C10H13F3N2S |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-pyrrolidin-2-yl-2-(3,3,3-trifluoropropyl)-1,3-thiazole |
| SMILES | FC(F)(F)CCc1nc(C2CCCN2)cs1 |
| InChI | InChI=1S/C10H13F3N2S/c11-10(12,13)4-3-9-15-8(6-16-9)7-2-1-5-14-7/h6-7,14H,1-5H2 |
| InChIKey | ITXRFVDWVRKDNK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |