C10H13F4NOS — CID 103477033
4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole (PubChem CID 103477033) has the molecular formula C10H13F4NOS and a molecular weight of 271.28 g/mol. Its IUPAC name is 4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole.
| Compound Name | 4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 103477033 |
| Molecular Formula | C10H13F4NOS |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole |
| SMILES | CCCc1csc(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C10H13F4NOS/c1-2-3-7-5-17-8(15-7)4-16-6-10(13,14)9(11)12/h5,9H,2-4,6H2,1H3 |
| InChIKey | YZKOBBAXIDLXND-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|