C9H11F4NOS2 — CID 112753801
2-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-yl]ethanethiol (PubChem CID 112753801) has the molecular formula C9H11F4NOS2 and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-yl]ethanethiol.
| Compound Name | 2-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-yl]ethanethiol |
|---|---|
| PubChem CID | 112753801 |
| Molecular Formula | C9H11F4NOS2 |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-yl]ethanethiol |
| SMILES | FC(F)C(F)(F)COCc1nc(CCS)cs1 |
| InChI | InChI=1S/C9H11F4NOS2/c10-8(11)9(12,13)5-15-3-7-14-6(1-2-16)4-17-7/h4,8,16H,1-3,5H2 |
| InChIKey | YSPSKFMAKCUSMA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|