C10H10F4N4O2S — CID 103472885
4-[[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazol-2-amine (PubChem CID 103472885) has the molecular formula C10H10F4N4O2S and a molecular weight of 326.28 g/mol. Its IUPAC name is 4-[[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 103472885 |
| Molecular Formula | C10H10F4N4O2S |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4-[[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(Cc2nc(COCC(F)(F)C(F)F)no2)cs1 |
| InChI | InChI=1S/C10H10F4N4O2S/c11-8(12)10(13,14)4-19-2-6-17-7(20-18-6)1-5-3-21-9(15)16-5/h3,8H,1-2,4H2,(H2,15,16) |
| InChIKey | XWXZQQDYGKGWLY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|