C11H17F4N3O2 — CID 103473064
3-methyl-1-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]butan-2-amine (PubChem CID 103473064) has the molecular formula C11H17F4N3O2 and a molecular weight of 299.27 g/mol. Its IUPAC name is 3-methyl-1-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]butan-2-amine.
| Compound Name | 3-methyl-1-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]butan-2-amine |
|---|---|
| PubChem CID | 103473064 |
| Molecular Formula | C11H17F4N3O2 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-methyl-1-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]butan-2-amine |
| SMILES | CC(C)C(N)Cc1nc(COCC(F)(F)C(F)F)no1 |
| InChI | InChI=1S/C11H17F4N3O2/c1-6(2)7(16)3-9-17-8(18-20-9)4-19-5-11(14,15)10(12)13/h6-7,10H,3-5,16H2,1-2H3 |
| InChIKey | XPLKRUQSCKOEES-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|