C11H15F4N3O3 — CID 103473115
5-[(3-methylazetidin-3-yl)oxymethyl]-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazole (PubChem CID 103473115) has the molecular formula C11H15F4N3O3 and a molecular weight of 313.25 g/mol. Its IUPAC name is 5-[(3-methylazetidin-3-yl)oxymethyl]-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(3-methylazetidin-3-yl)oxymethyl]-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103473115 |
| Molecular Formula | C11H15F4N3O3 |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 5-[(3-methylazetidin-3-yl)oxymethyl]-3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazole |
| SMILES | CC1(OCc2nc(COCC(F)(F)C(F)F)no2)CNC1 |
| InChI | InChI=1S/C11H15F4N3O3/c1-10(4-16-5-10)20-3-8-17-7(18-21-8)2-19-6-11(14,15)9(12)13/h9,16H,2-6H2,1H3 |
| InChIKey | ZSGJGXGKUBUALS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|