C12H19F4N3O2 — CID 103472897
2-methyl-N-[2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]propan-2-amine (PubChem CID 103472897) has the molecular formula C12H19F4N3O2 and a molecular weight of 313.30 g/mol. Its IUPAC name is 2-methyl-N-[2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]propan-2-amine.
| Compound Name | 2-methyl-N-[2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 103472897 |
| Molecular Formula | C12H19F4N3O2 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-methyl-N-[2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]propan-2-amine |
| SMILES | CC(C)(C)NCCc1nc(COCC(F)(F)C(F)F)no1 |
| InChI | InChI=1S/C12H19F4N3O2/c1-11(2,3)17-5-4-9-18-8(19-21-9)6-20-7-12(15,16)10(13)14/h10,17H,4-7H2,1-3H3 |
| InChIKey | LEBPKGFTQWSJII-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|