C10H13F4N3O2 — CID 103473159
[1-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]cyclopropyl]methanamine (PubChem CID 103473159) has the molecular formula C10H13F4N3O2 and a molecular weight of 283.23 g/mol. Its IUPAC name is [1-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]cyclopropyl]methanamine.
| Compound Name | [1-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]cyclopropyl]methanamine |
|---|---|
| PubChem CID | 103473159 |
| Molecular Formula | C10H13F4N3O2 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | [1-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]cyclopropyl]methanamine |
| SMILES | NCC1(c2nc(COCC(F)(F)C(F)F)no2)CC1 |
| InChI | InChI=1S/C10H13F4N3O2/c11-7(12)10(13,14)5-18-3-6-16-8(19-17-6)9(4-15)1-2-9/h7H,1-5,15H2 |
| InChIKey | NSZAXJWOKYKLSN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|