C10H13F4N3O3 — CID 103472972
(3R,5R)-5-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol (PubChem CID 103472972) has the molecular formula C10H13F4N3O3 and a molecular weight of 299.22 g/mol. Its IUPAC name is (3R,5R)-5-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol.
| Compound Name | (3R,5R)-5-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 103472972 |
| Molecular Formula | C10H13F4N3O3 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (3R,5R)-5-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
| SMILES | O[C@H]1CN[C@@H](c2nc(COCC(F)(F)C(F)F)no2)C1 |
| InChI | InChI=1S/C10H13F4N3O3/c11-9(12)10(13,14)4-19-3-7-16-8(20-17-7)6-1-5(18)2-15-6/h5-6,9,15,18H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | PNGRJRUNUGPCPK-PHDIDXHHSA-N |
| XLogP | 0.88 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|