C10H15F2N3O3 — CID 103146226
(3R,5R)-5-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol (PubChem CID 103146226) has the molecular formula C10H15F2N3O3 and a molecular weight of 263.24 g/mol. Its IUPAC name is (3R,5R)-5-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol.
| Compound Name | (3R,5R)-5-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 103146226 |
| Molecular Formula | C10H15F2N3O3 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (3R,5R)-5-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
| SMILES | O[C@H]1CN[C@@H](c2nc(CCOCC(F)F)no2)C1 |
| InChI | InChI=1S/C10H15F2N3O3/c11-8(12)5-17-2-1-9-14-10(18-15-9)7-3-6(16)4-13-7/h6-8,13,16H,1-5H2/t6-,7-/m1/s1 |
| InChIKey | MNSBZRGQGHZHLZ-RNFRBKRXSA-N |
| XLogP | 0.29 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|