C11H19NS — CID 55271530
2-pentyl-4-propyl-1,3-thiazole (PubChem CID 55271530) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is 2-pentyl-4-propyl-1,3-thiazole.
| Compound Name | 2-pentyl-4-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 55271530 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-pentyl-4-propyl-1,3-thiazole |
| SMILES | CCCCCc1nc(CCC)cs1 |
| InChI | InChI=1S/C11H19NS/c1-3-5-6-8-11-12-10(7-4-2)9-13-11/h9H,3-8H2,1-2H3 |
| InChIKey | HZWDDRTWBCHNGJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|