C9H16N2S — CID 69371976
(4-pentyl-1,3-thiazol-2-yl)methanamine (PubChem CID 69371976) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is (4-pentyl-1,3-thiazol-2-yl)methanamine.
| Compound Name | (4-pentyl-1,3-thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 69371976 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (4-pentyl-1,3-thiazol-2-yl)methanamine |
| SMILES | CCCCCc1csc(CN)n1 |
| InChI | InChI=1S/C9H16N2S/c1-2-3-4-5-8-7-12-9(6-10)11-8/h7H,2-6,10H2,1H3 |
| InChIKey | LMNQXPGYQPFCEA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|