C12H21N3OS — CID 82547831
2-[2-(aminomethyl)-1,3-thiazol-4-yl]-N-hexylacetamide (PubChem CID 82547831) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-1,3-thiazol-4-yl]-N-hexylacetamide.
| Compound Name | 2-[2-(aminomethyl)-1,3-thiazol-4-yl]-N-hexylacetamide |
|---|---|
| PubChem CID | 82547831 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-[2-(aminomethyl)-1,3-thiazol-4-yl]-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)Cc1csc(CN)n1 |
| InChI | InChI=1S/C12H21N3OS/c1-2-3-4-5-6-14-11(16)7-10-9-17-12(8-13)15-10/h9H,2-8,13H2,1H3,(H,14,16) |
| InChIKey | UZGBDVYHSITREP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|