C16H22N2S — CID 102625963
[4-(4-hexyl-1,3-thiazol-2-yl)phenyl]methanamine (PubChem CID 102625963) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is [4-(4-hexyl-1,3-thiazol-2-yl)phenyl]methanamine.
| Compound Name | [4-(4-hexyl-1,3-thiazol-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 102625963 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | [4-(4-hexyl-1,3-thiazol-2-yl)phenyl]methanamine |
| SMILES | CCCCCCc1csc(-c2ccc(CN)cc2)n1 |
| InChI | InChI=1S/C16H22N2S/c1-2-3-4-5-6-15-12-19-16(18-15)14-9-7-13(11-17)8-10-14/h7-10,12H,2-6,11,17H2,1H3 |
| InChIKey | FCQPQIZQLNIWKB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|