C14H14F3NS — CID 141123760
4-butyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (PubChem CID 141123760) has the molecular formula C14H14F3NS and a molecular weight of 285.33 g/mol. Its IUPAC name is 4-butyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole.
| Compound Name | 4-butyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 141123760 |
| Molecular Formula | C14H14F3NS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 4-butyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
| SMILES | CCCCc1csc(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C14H14F3NS/c1-2-3-4-12-9-19-13(18-12)10-5-7-11(8-6-10)14(15,16)17/h5-9H,2-4H2,1H3 |
| InChIKey | OGAFHFVDPQXPQQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |