C16H15F3N2O3S — CID 7163682
ethyl 2-oxo-2-[2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethylamino]acetate (PubChem CID 7163682) has the molecular formula C16H15F3N2O3S and a molecular weight of 372.37 g/mol. Its IUPAC name is ethyl 2-oxo-2-[2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethylamino]acetate.
| Compound Name | ethyl 2-oxo-2-[2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethylamino]acetate |
|---|---|
| PubChem CID | 7163682 |
| Molecular Formula | C16H15F3N2O3S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | ethyl 2-oxo-2-[2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethylamino]acetate |
| SMILES | CCOC(=O)C(=O)NCCc1csc(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C16H15F3N2O3S/c1-2-24-15(23)13(22)20-8-7-12-9-25-14(21-12)10-3-5-11(6-4-10)16(17,18)19/h3-6,9H,2,7-8H2,1H3,(H,20,22) |
| InChIKey | PIRJPCFFTBHHPD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|