C21H17ClF3N3O2S — CID 26843117
N'-(5-chloro-2-methylphenyl)-N-[2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethyl]oxamide (PubChem CID 26843117) has the molecular formula C21H17ClF3N3O2S and a molecular weight of 467.90 g/mol. Its IUPAC name is N'-(5-chloro-2-methylphenyl)-N-[2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethyl]oxamide.
| Compound Name | N'-(5-chloro-2-methylphenyl)-N-[2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 26843117 |
| Molecular Formula | C21H17ClF3N3O2S |
| Molecular Weight | 467.90 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | N'-(5-chloro-2-methylphenyl)-N-[2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethyl]oxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(=O)NCCc1csc(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C21H17ClF3N3O2S/c1-12-2-7-15(22)10-17(12)28-19(30)18(29)26-9-8-16-11-31-20(27-16)13-3-5-14(6-4-13)21(23,24)25/h2-7,10-11H,8-9H2,1H3,(H,26,29)(H,28,30) |
| InChIKey | AICWYVDHWLOKHT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.90 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|