C17H20FN3O2S — CID 7522183
N'-tert-butyl-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]oxamide (PubChem CID 7522183) has the molecular formula C17H20FN3O2S and a molecular weight of 349.43 g/mol. Its IUPAC name is N'-tert-butyl-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]oxamide.
| Compound Name | N'-tert-butyl-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 7522183 |
| Molecular Formula | C17H20FN3O2S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N'-tert-butyl-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]oxamide |
| SMILES | CC(C)(C)NC(=O)C(=O)NCCc1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H20FN3O2S/c1-17(2,3)21-15(23)14(22)19-9-8-13-10-24-16(20-13)11-4-6-12(18)7-5-11/h4-7,10H,8-9H2,1-3H3,(H,19,22)(H,21,23) |
| InChIKey | FABNSRHUODDIQV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|