C19H16FN3O2S — CID 7522158
N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]-N'-phenyloxamide (PubChem CID 7522158) has the molecular formula C19H16FN3O2S and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]-N'-phenyloxamide.
| Compound Name | N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]-N'-phenyloxamide |
|---|---|
| PubChem CID | 7522158 |
| Molecular Formula | C19H16FN3O2S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]-N'-phenyloxamide |
| SMILES | O=C(NCCc1csc(-c2ccc(F)cc2)n1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H16FN3O2S/c20-14-8-6-13(7-9-14)19-23-16(12-26-19)10-11-21-17(24)18(25)22-15-4-2-1-3-5-15/h1-9,12H,10-11H2,(H,21,24)(H,22,25) |
| InChIKey | MTQWSKJVQOTXNM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|